About 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine
6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine (PubChem CID 66300257) has the molecular formula C8H12IN3
and a molecular weight of 277.11 g/mol. Its IUPAC name is 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine |
| PubChem CID | 66300257 |
| Molecular Formula | C8H12IN3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine |
| SMILES | CCc1nc(C)nc(NC)c1I |
| InChI | InChI=1S/C8H12IN3/c1-4-6-7(9)8(10-3)12-5(2)11-6/h4H2,1-3H3,(H,10,11,12) |
| InChIKey | YMGQXRLLKYVWBJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine?
The IUPAC name of 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine (CID 66300257) is 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine.
What is the SMILES notation for 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine?
The canonical SMILES for 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine is CCc1nc(C)nc(NC)c1I.
What is the InChIKey of 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine?
The InChIKey is YMGQXRLLKYVWBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12IN3/c1-4-6-7(9)8(10-3)12-5(2)11-6/h4H2,1-3H3,(H,10,11,12).
What are the key properties of 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine?
6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine has a molecular weight of 277.11 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5-iodo-N,2-dimethylpyrimidin-4-amine is sourced from PubChem (CID 66300257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).