C16H26IN3 — CID 66301128
2-cycloheptyl-N-ethyl-5-iodo-6-propan-2-ylpyrimidin-4-amine (PubChem CID 66301128) has the molecular formula C16H26IN3 and a molecular weight of 387.31 g/mol. Its IUPAC name is 2-cycloheptyl-N-ethyl-5-iodo-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-cycloheptyl-N-ethyl-5-iodo-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66301128 |
| Molecular Formula | C16H26IN3 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-cycloheptyl-N-ethyl-5-iodo-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CCNc1nc(C2CCCCCC2)nc(C(C)C)c1I |
| InChI | InChI=1S/C16H26IN3/c1-4-18-16-13(17)14(11(2)3)19-15(20-16)12-9-7-5-6-8-10-12/h11-12H,4-10H2,1-3H3,(H,18,19,20) |
| InChIKey | GRSJUHKIPNYGPM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|