C14H14F2IN3O — CID 66302417
2-[(2,4-difluorophenyl)methyl]-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine (PubChem CID 66302417) has the molecular formula C14H14F2IN3O and a molecular weight of 405.19 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methyl]-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine.
| Compound Name | 2-[(2,4-difluorophenyl)methyl]-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66302417 |
| Molecular Formula | C14H14F2IN3O |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methyl]-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(Cc2ccc(F)cc2F)nc(COC)c1I |
| InChI | InChI=1S/C14H14F2IN3O/c1-18-14-13(17)11(7-21-2)19-12(20-14)5-8-3-4-9(15)6-10(8)16/h3-4,6H,5,7H2,1-2H3,(H,18,19,20) |
| InChIKey | CPXQQIYLWFDLGW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|