C15H16IN3 — CID 66302773
6-cyclopropyl-5-iodo-N-methyl-2-(4-methylphenyl)pyrimidin-4-amine (PubChem CID 66302773) has the molecular formula C15H16IN3 and a molecular weight of 365.22 g/mol. Its IUPAC name is 6-cyclopropyl-5-iodo-N-methyl-2-(4-methylphenyl)pyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-5-iodo-N-methyl-2-(4-methylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66302773 |
| Molecular Formula | C15H16IN3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 6-cyclopropyl-5-iodo-N-methyl-2-(4-methylphenyl)pyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccc(C)cc2)nc(C2CC2)c1I |
| InChI | InChI=1S/C15H16IN3/c1-9-3-5-11(6-4-9)14-18-13(10-7-8-10)12(16)15(17-2)19-14/h3-6,10H,7-8H2,1-2H3,(H,17,18,19) |
| InChIKey | OHPMAKDBKKZHGF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|