C14H14IN3 — CID 66304538
2-(2,3-dihydro-1H-inden-2-yl)-5-iodo-N-methylpyrimidin-4-amine (PubChem CID 66304538) has the molecular formula C14H14IN3 and a molecular weight of 351.19 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-2-yl)-5-iodo-N-methylpyrimidin-4-amine.
| Compound Name | 2-(2,3-dihydro-1H-inden-2-yl)-5-iodo-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66304538 |
| Molecular Formula | C14H14IN3 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-2-yl)-5-iodo-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(C2Cc3ccccc3C2)ncc1I |
| InChI | InChI=1S/C14H14IN3/c1-16-14-12(15)8-17-13(18-14)11-6-9-4-2-3-5-10(9)7-11/h2-5,8,11H,6-7H2,1H3,(H,16,17,18) |
| InChIKey | PBSCAOOZGZLTOI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|