C12H11FIN3S — CID 66305099
2-[(2-fluorophenyl)sulfanylmethyl]-5-iodo-6-methylpyrimidin-4-amine (PubChem CID 66305099) has the molecular formula C12H11FIN3S and a molecular weight of 375.21 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfanylmethyl]-5-iodo-6-methylpyrimidin-4-amine.
| Compound Name | 2-[(2-fluorophenyl)sulfanylmethyl]-5-iodo-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66305099 |
| Molecular Formula | C12H11FIN3S |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfanylmethyl]-5-iodo-6-methylpyrimidin-4-amine |
| SMILES | Cc1nc(CSc2ccccc2F)nc(N)c1I |
| InChI | InChI=1S/C12H11FIN3S/c1-7-11(14)12(15)17-10(16-7)6-18-9-5-3-2-4-8(9)13/h2-5H,6H2,1H3,(H2,15,16,17) |
| InChIKey | JIHGWJRCFIYXAU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|