C14H14F2IN3 — CID 66305379
2-[(3,5-difluorophenyl)methyl]-5-iodo-6-propylpyrimidin-4-amine (PubChem CID 66305379) has the molecular formula C14H14F2IN3 and a molecular weight of 389.19 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-5-iodo-6-propylpyrimidin-4-amine.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-5-iodo-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66305379 |
| Molecular Formula | C14H14F2IN3 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-5-iodo-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Cc2cc(F)cc(F)c2)nc(N)c1I |
| InChI | InChI=1S/C14H14F2IN3/c1-2-3-11-13(17)14(18)20-12(19-11)6-8-4-9(15)7-10(16)5-8/h4-5,7H,2-3,6H2,1H3,(H2,18,19,20) |
| InChIKey | PFOLAIQHDQMVBL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|