C15H24BrN3O2 — CID 66305829
5-bromo-6-tert-butyl-2-(1,4-dioxan-2-yl)-N-propylpyrimidin-4-amine (PubChem CID 66305829) has the molecular formula C15H24BrN3O2 and a molecular weight of 358.28 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-(1,4-dioxan-2-yl)-N-propylpyrimidin-4-amine.
| Compound Name | 5-bromo-6-tert-butyl-2-(1,4-dioxan-2-yl)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66305829 |
| Molecular Formula | C15H24BrN3O2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-(1,4-dioxan-2-yl)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(C2COCCO2)nc(C(C)(C)C)c1Br |
| InChI | InChI=1S/C15H24BrN3O2/c1-5-6-17-14-11(16)12(15(2,3)4)18-13(19-14)10-9-20-7-8-21-10/h10H,5-9H2,1-4H3,(H,17,18,19) |
| InChIKey | QDQGPFLOKBYTJF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |