C15H16IN3 — CID 66307689
5-iodo-6-methyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidin-4-amine (PubChem CID 66307689) has the molecular formula C15H16IN3 and a molecular weight of 365.22 g/mol. Its IUPAC name is 5-iodo-6-methyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidin-4-amine.
| Compound Name | 5-iodo-6-methyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66307689 |
| Molecular Formula | C15H16IN3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 5-iodo-6-methyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidin-4-amine |
| SMILES | Cc1nc(C2CCc3ccccc3C2)nc(N)c1I |
| InChI | InChI=1S/C15H16IN3/c1-9-13(16)14(17)19-15(18-9)12-7-6-10-4-2-3-5-11(10)8-12/h2-5,12H,6-8H2,1H3,(H2,17,18,19) |
| InChIKey | ACBZSWXHOFUGIP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|