About 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine
2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine (PubChem CID 663078) has the molecular formula C11H13N3OS
and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine |
| PubChem CID | 663078 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine |
| SMILES | NCCc1nnc(SCc2ccccc2)o1 |
| InChI | InChI=1S/C11H13N3OS/c12-7-6-10-13-14-11(15-10)16-8-9-4-2-1-3-5-9/h1-5H,6-8,12H2 |
| InChIKey | SFSSDSVHQINECU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
The IUPAC name of 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine (CID 663078) is 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine.
What is the SMILES notation for 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
The canonical SMILES for 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine is NCCc1nnc(SCc2ccccc2)o1.
What is the InChIKey of 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
The InChIKey is SFSSDSVHQINECU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3OS/c12-7-6-10-13-14-11(15-10)16-8-9-4-2-1-3-5-9/h1-5H,6-8,12H2.
What are the key properties of 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine has a molecular weight of 235.31 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine is sourced from PubChem (CID 663078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).