About 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one
5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one (PubChem CID 66308079) has the molecular formula C8H11BrN2O3
and a molecular weight of 263.09 g/mol. Its IUPAC name is 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one |
| PubChem CID | 66308079 |
| Molecular Formula | C8H11BrN2O3 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one |
| SMILES | COC(Cn1cncc(Br)c1=O)OC |
| InChI | InChI=1S/C8H11BrN2O3/c1-13-7(14-2)4-11-5-10-3-6(9)8(11)12/h3,5,7H,4H2,1-2H3 |
| InChIKey | YWQBRMSWJKSMOL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one?
The IUPAC name of 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one (CID 66308079) is 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one.
What is the SMILES notation for 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one?
The canonical SMILES for 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one is COC(Cn1cncc(Br)c1=O)OC.
What is the InChIKey of 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one?
The InChIKey is YWQBRMSWJKSMOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2O3/c1-13-7(14-2)4-11-5-10-3-6(9)8(11)12/h3,5,7H,4H2,1-2H3.
What are the key properties of 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one?
5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one has a molecular weight of 263.09 g/mol, XLogP of 0.62, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(2,2-dimethoxyethyl)pyrimidin-4-one is sourced from PubChem (CID 66308079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).