About 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide
2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide (PubChem CID 663088) has the molecular formula C20H28N4O4S
and a molecular weight of 420.54 g/mol. Its IUPAC name is 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide |
| PubChem CID | 663088 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COn1c(SCC(=O)N(CC)CC)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H28N4O4S/c1-5-22(6-2)17(25)13-28-24-19(27)15-11-9-10-12-16(15)21-20(24)29-14-18(26)23(7-3)8-4/h9-12H,5-8,13-14H2,1-4H3 |
| InChIKey | XOWPGLABLGZTBB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide?
The IUPAC name of 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide (CID 663088) is 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide.
What is the SMILES notation for 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide?
The canonical SMILES for 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide is CCN(CC)C(=O)COn1c(SCC(=O)N(CC)CC)nc2ccccc2c1=O.
What is the InChIKey of 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide?
The InChIKey is XOWPGLABLGZTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O4S/c1-5-22(6-2)17(25)13-28-24-19(27)15-11-9-10-12-16(15)21-20(24)29-14-18(26)23(7-3)8-4/h9-12H,5-8,13-14H2,1-4H3.
What are the key properties of 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide?
2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide has a molecular weight of 420.54 g/mol, XLogP of 1.65, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(diethylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]oxy-N,N-diethylacetamide is sourced from PubChem (CID 663088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).