C11H9BrN2O4 — CID 66308953
3-[(5-bromo-4-methyl-6-oxopyrimidin-1-yl)methyl]furan-2-carboxylic acid (PubChem CID 66308953) has the molecular formula C11H9BrN2O4 and a molecular weight of 313.11 g/mol. Its IUPAC name is 3-[(5-bromo-4-methyl-6-oxopyrimidin-1-yl)methyl]furan-2-carboxylic acid.
| Compound Name | 3-[(5-bromo-4-methyl-6-oxopyrimidin-1-yl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 66308953 |
| Molecular Formula | C11H9BrN2O4 |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 3-[(5-bromo-4-methyl-6-oxopyrimidin-1-yl)methyl]furan-2-carboxylic acid |
| SMILES | Cc1ncn(Cc2ccoc2C(=O)O)c(=O)c1Br |
| InChI | InChI=1S/C11H9BrN2O4/c1-6-8(12)10(15)14(5-13-6)4-7-2-3-18-9(7)11(16)17/h2-3,5H,4H2,1H3,(H,16,17) |
| InChIKey | DTFLHEFSYUUWKE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |