About 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one
5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one (PubChem CID 66309206) has the molecular formula C11H16BrN3O3S
and a molecular weight of 350.24 g/mol. Its IUPAC name is 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one |
| PubChem CID | 66309206 |
| Molecular Formula | C11H16BrN3O3S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(CCNC2CCS(=O)(=O)C2)c(=O)c1Br |
| InChI | InChI=1S/C11H16BrN3O3S/c1-8-10(12)11(16)15(7-14-8)4-3-13-9-2-5-19(17,18)6-9/h7,9,13H,2-6H2,1H3 |
| InChIKey | ITQPFYBYFOCWHK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one?
The IUPAC name of 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one (CID 66309206) is 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one.
What is the SMILES notation for 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one?
The canonical SMILES for 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one is Cc1ncn(CCNC2CCS(=O)(=O)C2)c(=O)c1Br.
What is the InChIKey of 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one?
The InChIKey is ITQPFYBYFOCWHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrN3O3S/c1-8-10(12)11(16)15(7-14-8)4-3-13-9-2-5-19(17,18)6-9/h7,9,13H,2-6H2,1H3.
What are the key properties of 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one?
5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one has a molecular weight of 350.24 g/mol, XLogP of 0.09, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]-6-methylpyrimidin-4-one is sourced from PubChem (CID 66309206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).