About 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile
5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile (PubChem CID 66310780) has the molecular formula C11H14IN3O
and a molecular weight of 331.16 g/mol. Its IUPAC name is 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile |
| PubChem CID | 66310780 |
| Molecular Formula | C11H14IN3O |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCn1cncc(I)c1=O |
| InChI | InChI=1S/C11H14IN3O/c1-11(2,7-13)4-3-5-15-8-14-6-9(12)10(15)16/h6,8H,3-5H2,1-2H3 |
| InChIKey | NAJFMOINJOFHTD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile?
The IUPAC name of 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile (CID 66310780) is 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile is CC(C)(C#N)CCCn1cncc(I)c1=O.
What is the InChIKey of 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile?
The InChIKey is NAJFMOINJOFHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14IN3O/c1-11(2,7-13)4-3-5-15-8-14-6-9(12)10(15)16/h6,8H,3-5H2,1-2H3.
What are the key properties of 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile?
5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile has a molecular weight of 331.16 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-iodo-6-oxopyrimidin-1-yl)-2,2-dimethylpentanenitrile is sourced from PubChem (CID 66310780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).