About 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one
5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one (PubChem CID 66310899) has the molecular formula C8H8BrF3N2O
and a molecular weight of 285.06 g/mol. Its IUPAC name is 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one |
| PubChem CID | 66310899 |
| Molecular Formula | C8H8BrF3N2O |
| Molecular Weight | 285.06 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one |
| SMILES | Cc1ncn(CCC(F)(F)F)c(=O)c1Br |
| InChI | InChI=1S/C8H8BrF3N2O/c1-5-6(9)7(15)14(4-13-5)3-2-8(10,11)12/h4H,2-3H2,1H3 |
| InChIKey | NGDIFDPOKHLDOZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.06 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one?
The IUPAC name of 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one (CID 66310899) is 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one.
What is the SMILES notation for 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one?
The canonical SMILES for 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one is Cc1ncn(CCC(F)(F)F)c(=O)c1Br.
What is the InChIKey of 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one?
The InChIKey is NGDIFDPOKHLDOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF3N2O/c1-5-6(9)7(15)14(4-13-5)3-2-8(10,11)12/h4H,2-3H2,1H3.
What are the key properties of 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one?
5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one has a molecular weight of 285.06 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-methyl-3-(3,3,3-trifluoropropyl)pyrimidin-4-one is sourced from PubChem (CID 66310899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).