About 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one
3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one (PubChem CID 66311009) has the molecular formula C8H9F3IN3O
and a molecular weight of 347.08 g/mol. Its IUPAC name is 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one |
| PubChem CID | 66311009 |
| Molecular Formula | C8H9F3IN3O |
| Molecular Weight | 347.08 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(C(CN)C(F)(F)F)c(=O)c1I |
| InChI | InChI=1S/C8H9F3IN3O/c1-4-6(12)7(16)15(3-14-4)5(2-13)8(9,10)11/h3,5H,2,13H2,1H3 |
| InChIKey | ZOVHQSACVQMTMZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.08 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one?
The IUPAC name of 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one (CID 66311009) is 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one.
What is the SMILES notation for 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one?
The canonical SMILES for 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one is Cc1ncn(C(CN)C(F)(F)F)c(=O)c1I.
What is the InChIKey of 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one?
The InChIKey is ZOVHQSACVQMTMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3IN3O/c1-4-6(12)7(16)15(3-14-4)5(2-13)8(9,10)11/h3,5H,2,13H2,1H3.
What are the key properties of 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one?
3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one has a molecular weight of 347.08 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-iodo-6-methylpyrimidin-4-one is sourced from PubChem (CID 66311009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).