C14H14IN3O3 — CID 66311012
3-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-5-iodo-6-methylpyrimidin-4-one (PubChem CID 66311012) has the molecular formula C14H14IN3O3 and a molecular weight of 399.19 g/mol. Its IUPAC name is 3-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-5-iodo-6-methylpyrimidin-4-one.
| Compound Name | 3-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-5-iodo-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 66311012 |
| Molecular Formula | C14H14IN3O3 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 3-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-5-iodo-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(Cc2cc3c(cc2N)OCCO3)c(=O)c1I |
| InChI | InChI=1S/C14H14IN3O3/c1-8-13(15)14(19)18(7-17-8)6-9-4-11-12(5-10(9)16)21-3-2-20-11/h4-5,7H,2-3,6,16H2,1H3 |
| InChIKey | ZQGVAZHVHSFEBP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|