About 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one
5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one (PubChem CID 66312195) has the molecular formula C9H8BrN3O2
and a molecular weight of 270.09 g/mol. Its IUPAC name is 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one |
| PubChem CID | 66312195 |
| Molecular Formula | C9H8BrN3O2 |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1noc(C)c1-c1ncc(Br)c(=O)[nH]1 |
| InChI | InChI=1S/C9H8BrN3O2/c1-4-7(5(2)15-13-4)8-11-3-6(10)9(14)12-8/h3H,1-2H3,(H,11,12,14) |
| InChIKey | VAXXDGPIYJMKNB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one?
The IUPAC name of 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one (CID 66312195) is 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one is Cc1noc(C)c1-c1ncc(Br)c(=O)[nH]1.
What is the InChIKey of 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one?
The InChIKey is VAXXDGPIYJMKNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3O2/c1-4-7(5(2)15-13-4)8-11-3-6(10)9(14)12-8/h3H,1-2H3,(H,11,12,14).
What are the key properties of 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one?
5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one has a molecular weight of 270.09 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 66312195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).