About 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one
5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one (PubChem CID 66312584) has the molecular formula C14H14BrN3O
and a molecular weight of 320.19 g/mol. Its IUPAC name is 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one |
| PubChem CID | 66312584 |
| Molecular Formula | C14H14BrN3O |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one |
| SMILES | CN1CCCc2cc(-c3ncc(Br)c(=O)[nH]3)ccc21 |
| InChI | InChI=1S/C14H14BrN3O/c1-18-6-2-3-9-7-10(4-5-12(9)18)13-16-8-11(15)14(19)17-13/h4-5,7-8H,2-3,6H2,1H3,(H,16,17,19) |
| InChIKey | XBAWEZBZLIRARL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one?
The IUPAC name of 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one (CID 66312584) is 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one is CN1CCCc2cc(-c3ncc(Br)c(=O)[nH]3)ccc21.
What is the InChIKey of 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one?
The InChIKey is XBAWEZBZLIRARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN3O/c1-18-6-2-3-9-7-10(4-5-12(9)18)13-16-8-11(15)14(19)17-13/h4-5,7-8H,2-3,6H2,1H3,(H,16,17,19).
What are the key properties of 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one?
5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one has a molecular weight of 320.19 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 66312584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).