C9H5BrCl2N2O — CID 66313382
5-bromo-4,6-dichloro-2-(5-methylfuran-2-yl)pyrimidine (PubChem CID 66313382) has the molecular formula C9H5BrCl2N2O and a molecular weight of 307.96 g/mol. Its IUPAC name is 5-bromo-4,6-dichloro-2-(5-methylfuran-2-yl)pyrimidine.
| Compound Name | 5-bromo-4,6-dichloro-2-(5-methylfuran-2-yl)pyrimidine |
|---|---|
| PubChem CID | 66313382 |
| Molecular Formula | C9H5BrCl2N2O |
| Molecular Weight | 307.96 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | 5-bromo-4,6-dichloro-2-(5-methylfuran-2-yl)pyrimidine |
| SMILES | Cc1ccc(-c2nc(Cl)c(Br)c(Cl)n2)o1 |
| InChI | InChI=1S/C9H5BrCl2N2O/c1-4-2-3-5(15-4)9-13-7(11)6(10)8(12)14-9/h2-3H,1H3 |
| InChIKey | FQXZTRCZGBICPP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.96 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |