C11H6BrCl2IN2S — CID 66314964
2-[(3-bromophenyl)sulfanylmethyl]-4,6-dichloro-5-iodopyrimidine (PubChem CID 66314964) has the molecular formula C11H6BrCl2IN2S and a molecular weight of 475.96 g/mol. Its IUPAC name is 2-[(3-bromophenyl)sulfanylmethyl]-4,6-dichloro-5-iodopyrimidine.
| Compound Name | 2-[(3-bromophenyl)sulfanylmethyl]-4,6-dichloro-5-iodopyrimidine |
|---|---|
| PubChem CID | 66314964 |
| Molecular Formula | C11H6BrCl2IN2S |
| Molecular Weight | 475.96 g/mol |
| Exact Mass | 473.79 |
| IUPAC Name | 2-[(3-bromophenyl)sulfanylmethyl]-4,6-dichloro-5-iodopyrimidine |
| SMILES | Clc1nc(CSc2cccc(Br)c2)nc(Cl)c1I |
| InChI | InChI=1S/C11H6BrCl2IN2S/c12-6-2-1-3-7(4-6)18-5-8-16-10(13)9(15)11(14)17-8/h1-4H,5H2 |
| InChIKey | OEBXXFKYWBXTFS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.96 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|