About 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one
5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one (PubChem CID 66316991) has the molecular formula C11H7BrCl2N2O
and a molecular weight of 334.00 g/mol. Its IUPAC name is 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one |
| PubChem CID | 66316991 |
| Molecular Formula | C11H7BrCl2N2O |
| Molecular Weight | 334.00 g/mol |
| Exact Mass | 331.91 |
| IUPAC Name | 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(Cc2c(Cl)cccc2Cl)ncc1Br |
| InChI | InChI=1S/C11H7BrCl2N2O/c12-7-5-15-10(16-11(7)17)4-6-8(13)2-1-3-9(6)14/h1-3,5H,4H2,(H,15,16,17) |
| InChIKey | RIIRWHQRIHSPJY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.00 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one?
The IUPAC name of 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one (CID 66316991) is 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one.
What is the SMILES notation for 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one?
The canonical SMILES for 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one is O=c1[nH]c(Cc2c(Cl)cccc2Cl)ncc1Br.
What is the InChIKey of 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one?
The InChIKey is RIIRWHQRIHSPJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrCl2N2O/c12-7-5-15-10(16-11(7)17)4-6-8(13)2-1-3-9(6)14/h1-3,5H,4H2,(H,15,16,17).
What are the key properties of 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one?
5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one has a molecular weight of 334.00 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one is sourced from PubChem (CID 66316991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).