6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid

C14H23N3O3 — CID 66318116

IUPAC6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid
SMILESCCOc1cc(NCCC(C)(C)CCC(=O)O)ncn1
InChIInChI=1S/C14H23N3O3/c1-4-20-12-9-11(16-10-17-12)15-8-7-14(2,3)6-5-13(18)19/h9-10H,4-8H2,1-3H3,(H,18,19)(H,15,16,17)
InChIKeyWEIMKPBSGLEGAB-UHFFFAOYSA-N
MW281.36 g/mol
LogP2.57
Rot. Bonds9

About 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid

6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid (PubChem CID 66318116) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid.

Molecular Properties

Compound Name6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid
PubChem CID66318116
Molecular FormulaC14H23N3O3
Molecular Weight281.36 g/mol
Exact Mass281.17
IUPAC Name6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid
SMILESCCOc1cc(NCCC(C)(C)CCC(=O)O)ncn1
InChIInChI=1S/C14H23N3O3/c1-4-20-12-9-11(16-10-17-12)15-8-7-14(2,3)6-5-13(18)19/h9-10H,4-8H2,1-3H3,(H,18,19)(H,15,16,17)
InChIKeyWEIMKPBSGLEGAB-UHFFFAOYSA-N
XLogP2.57
TPSA84.34 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.36
LogP ≤ 52.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid?
The IUPAC name of 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid (CID 66318116) is 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid.
What is the SMILES notation for 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid?
The canonical SMILES for 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid is CCOc1cc(NCCC(C)(C)CCC(=O)O)ncn1.
What is the InChIKey of 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid?
The InChIKey is WEIMKPBSGLEGAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3/c1-4-20-12-9-11(16-10-17-12)15-8-7-14(2,3)6-5-13(18)19/h9-10H,4-8H2,1-3H3,(H,18,19)(H,15,16,17).
What are the key properties of 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid?
6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid has a molecular weight of 281.36 g/mol, XLogP of 2.57, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid is sourced from PubChem (CID 66318116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).