C14H23N3O3 — CID 66318116
6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid (PubChem CID 66318116) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 66318116 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 6-[(6-ethoxypyrimidin-4-yl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CCOc1cc(NCCC(C)(C)CCC(=O)O)ncn1 |
| InChI | InChI=1S/C14H23N3O3/c1-4-20-12-9-11(16-10-17-12)15-8-7-14(2,3)6-5-13(18)19/h9-10H,4-8H2,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | WEIMKPBSGLEGAB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |