C21H26Cl2N6O3 — CID 663182
1-[(2,4-dichlorophenyl)methyl]-3,7-dimethyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione (PubChem CID 663182) has the molecular formula C21H26Cl2N6O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3,7-dimethyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3,7-dimethyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 663182 |
| Molecular Formula | C21H26Cl2N6O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3,7-dimethyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione |
| SMILES | Cn1c(NCCCN2CCOCC2)nc2c1c(=O)n(Cc1ccc(Cl)cc1Cl)c(=O)n2C |
| InChI | InChI=1S/C21H26Cl2N6O3/c1-26-17-18(25-20(26)24-6-3-7-28-8-10-32-11-9-28)27(2)21(31)29(19(17)30)13-14-4-5-15(22)12-16(14)23/h4-5,12H,3,6-11,13H2,1-2H3,(H,24,25) |
| InChIKey | KNKVLSZPBXRYLA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|