About N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine
N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 66319328) has the molecular formula C10H17IN4
and a molecular weight of 320.18 g/mol. Its IUPAC name is N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine |
| PubChem CID | 66319328 |
| Molecular Formula | C10H17IN4 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | CCCCN(CCN)c1ncncc1I |
| InChI | InChI=1S/C10H17IN4/c1-2-3-5-15(6-4-12)10-9(11)7-13-8-14-10/h7-8H,2-6,12H2,1H3 |
| InChIKey | CGARDOGJQYPWLN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine (CID 66319328) is N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine is CCCCN(CCN)c1ncncc1I.
What is the InChIKey of N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine?
The InChIKey is CGARDOGJQYPWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17IN4/c1-2-3-5-15(6-4-12)10-9(11)7-13-8-14-10/h7-8H,2-6,12H2,1H3.
What are the key properties of N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine?
N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine has a molecular weight of 320.18 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-N'-(5-iodopyrimidin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 66319328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).