About 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine
5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine (PubChem CID 66320751) has the molecular formula C7H6BrN5S
and a molecular weight of 272.13 g/mol. Its IUPAC name is 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine.
Molecular Properties
| Compound Name | 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine |
| PubChem CID | 66320751 |
| Molecular Formula | C7H6BrN5S |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine |
| SMILES | Cn1cnnc1Sc1ncncc1Br |
| InChI | InChI=1S/C7H6BrN5S/c1-13-4-11-12-7(13)14-6-5(8)2-9-3-10-6/h2-4H,1H3 |
| InChIKey | FTECNBGDGGHJSU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine?
The IUPAC name of 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine (CID 66320751) is 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine.
What is the SMILES notation for 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine?
The canonical SMILES for 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine is Cn1cnnc1Sc1ncncc1Br.
What is the InChIKey of 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine?
The InChIKey is FTECNBGDGGHJSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN5S/c1-13-4-11-12-7(13)14-6-5(8)2-9-3-10-6/h2-4H,1H3.
What are the key properties of 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine?
5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine has a molecular weight of 272.13 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine is sourced from PubChem (CID 66320751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).