About cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate
cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate (PubChem CID 66321572) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate |
| PubChem CID | 66321572 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate |
| SMILES | CC1CNCC1C(=O)OCC1CCCC1 |
| InChI | InChI=1S/C12H21NO2/c1-9-6-13-7-11(9)12(14)15-8-10-4-2-3-5-10/h9-11,13H,2-8H2,1H3 |
| InChIKey | ISZMSNRCOOYXMM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate?
The IUPAC name of cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate (CID 66321572) is cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate.
What is the SMILES notation for cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate?
The canonical SMILES for cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate is CC1CNCC1C(=O)OCC1CCCC1.
What is the InChIKey of cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate?
The InChIKey is ISZMSNRCOOYXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-9-6-13-7-11(9)12(14)15-8-10-4-2-3-5-10/h9-11,13H,2-8H2,1H3.
What are the key properties of cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate?
cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate has a molecular weight of 211.30 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethyl 4-methylpyrrolidine-3-carboxylate is sourced from PubChem (CID 66321572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).