About cyclopentylmethyl 2-amino-3,3-dimethylbutanoate
cyclopentylmethyl 2-amino-3,3-dimethylbutanoate (PubChem CID 66321580) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is cyclopentylmethyl 2-amino-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | cyclopentylmethyl 2-amino-3,3-dimethylbutanoate |
| PubChem CID | 66321580 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | cyclopentylmethyl 2-amino-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)C(N)C(=O)OCC1CCCC1 |
| InChI | InChI=1S/C12H23NO2/c1-12(2,3)10(13)11(14)15-8-9-6-4-5-7-9/h9-10H,4-8,13H2,1-3H3 |
| InChIKey | ZVHSIOYEUKGEQW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentylmethyl 2-amino-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethyl 2-amino-3,3-dimethylbutanoate?
The IUPAC name of cyclopentylmethyl 2-amino-3,3-dimethylbutanoate (CID 66321580) is cyclopentylmethyl 2-amino-3,3-dimethylbutanoate.
What is the SMILES notation for cyclopentylmethyl 2-amino-3,3-dimethylbutanoate?
The canonical SMILES for cyclopentylmethyl 2-amino-3,3-dimethylbutanoate is CC(C)(C)C(N)C(=O)OCC1CCCC1.
What is the InChIKey of cyclopentylmethyl 2-amino-3,3-dimethylbutanoate?
The InChIKey is ZVHSIOYEUKGEQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-12(2,3)10(13)11(14)15-8-9-6-4-5-7-9/h9-10H,4-8,13H2,1-3H3.
What are the key properties of cyclopentylmethyl 2-amino-3,3-dimethylbutanoate?
cyclopentylmethyl 2-amino-3,3-dimethylbutanoate has a molecular weight of 213.32 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethyl 2-amino-3,3-dimethylbutanoate is sourced from PubChem (CID 66321580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).