About 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione
1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione (PubChem CID 66321921) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione |
| PubChem CID | 66321921 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione |
| SMILES | CCc1cn(Cc2cncn2C2CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H16N4O2/c1-2-9-6-16(13(19)15-12(9)18)7-11-5-14-8-17(11)10-3-4-10/h5-6,8,10H,2-4,7H2,1H3,(H,15,18,19) |
| InChIKey | IRQFKKXGESNTBJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione?
The IUPAC name of 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione (CID 66321921) is 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione.
What is the SMILES notation for 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione?
The canonical SMILES for 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione is CCc1cn(Cc2cncn2C2CC2)c(=O)[nH]c1=O.
What is the InChIKey of 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione?
The InChIKey is IRQFKKXGESNTBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c1-2-9-6-16(13(19)15-12(9)18)7-11-5-14-8-17(11)10-3-4-10/h5-6,8,10H,2-4,7H2,1H3,(H,15,18,19).
What are the key properties of 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione?
1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione has a molecular weight of 260.30 g/mol, XLogP of 0.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-ethylpyrimidine-2,4-dione is sourced from PubChem (CID 66321921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).