About 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine
6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 66322144) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine.
Molecular Properties
| Compound Name | 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine |
| PubChem CID | 66322144 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Nc1cc2c(cc1OCC1CCCC1)OCCO2 |
| InChI | InChI=1S/C14H19NO3/c15-11-7-13-14(17-6-5-16-13)8-12(11)18-9-10-3-1-2-4-10/h7-8,10H,1-6,9,15H2 |
| InChIKey | BOYWCARORYAFIC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine?
The IUPAC name of 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine (CID 66322144) is 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine.
What is the SMILES notation for 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine?
The canonical SMILES for 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine is Nc1cc2c(cc1OCC1CCCC1)OCCO2.
What is the InChIKey of 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine?
The InChIKey is BOYWCARORYAFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c15-11-7-13-14(17-6-5-16-13)8-12(11)18-9-10-3-1-2-4-10/h7-8,10H,1-6,9,15H2.
What are the key properties of 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine?
6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine has a molecular weight of 249.31 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclopentylmethoxy)-2,3-dihydro-1,4-benzodioxin-7-amine is sourced from PubChem (CID 66322144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).