3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid

C7H12O5S — CID 66322776

IUPAC3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid
SMILESO=C(O)CCC1(O)CCS(=O)(=O)C1
InChIInChI=1S/C7H12O5S/c8-6(9)1-2-7(10)3-4-13(11,12)5-7/h10H,1-5H2,(H,8,9)
InChIKeyAUVMVVNAOAXLNX-UHFFFAOYSA-N
MW208.23 g/mol
LogP-0.60
Rot. Bonds3

About 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid

3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid (PubChem CID 66322776) has the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. Its IUPAC name is 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid.

Molecular Properties

Compound Name3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid
PubChem CID66322776
Molecular FormulaC7H12O5S
Molecular Weight208.23 g/mol
Exact Mass208.04
IUPAC Name3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid
SMILESO=C(O)CCC1(O)CCS(=O)(=O)C1
InChIInChI=1S/C7H12O5S/c8-6(9)1-2-7(10)3-4-13(11,12)5-7/h10H,1-5H2,(H,8,9)
InChIKeyAUVMVVNAOAXLNX-UHFFFAOYSA-N
XLogP-0.60
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.23
LogP ≤ 5-0.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid?
The IUPAC name of 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid (CID 66322776) is 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid.
What is the SMILES notation for 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid?
The canonical SMILES for 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid is O=C(O)CCC1(O)CCS(=O)(=O)C1.
What is the InChIKey of 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid?
The InChIKey is AUVMVVNAOAXLNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O5S/c8-6(9)1-2-7(10)3-4-13(11,12)5-7/h10H,1-5H2,(H,8,9).
What are the key properties of 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid?
3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid has a molecular weight of 208.23 g/mol, XLogP of -0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoic acid is sourced from PubChem (CID 66322776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).