C16H23FN2O2 — CID 66322803
N-(3-amino-4-fluorophenyl)-4-(cyclopentylmethoxy)butanamide (PubChem CID 66322803) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-4-(cyclopentylmethoxy)butanamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-4-(cyclopentylmethoxy)butanamide |
|---|---|
| PubChem CID | 66322803 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-4-(cyclopentylmethoxy)butanamide |
| SMILES | Nc1cc(NC(=O)CCCOCC2CCCC2)ccc1F |
| InChI | InChI=1S/C16H23FN2O2/c17-14-8-7-13(10-15(14)18)19-16(20)6-3-9-21-11-12-4-1-2-5-12/h7-8,10,12H,1-6,9,11,18H2,(H,19,20) |
| InChIKey | GGEQPQMREFMGGU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|