C11H19N3O3S — CID 66325292
6-ethoxy-2-methyl-N-(1-methylsulfonylpropan-2-yl)pyrimidin-4-amine (PubChem CID 66325292) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 6-ethoxy-2-methyl-N-(1-methylsulfonylpropan-2-yl)pyrimidin-4-amine.
| Compound Name | 6-ethoxy-2-methyl-N-(1-methylsulfonylpropan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66325292 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 6-ethoxy-2-methyl-N-(1-methylsulfonylpropan-2-yl)pyrimidin-4-amine |
| SMILES | CCOc1cc(NC(C)CS(C)(=O)=O)nc(C)n1 |
| InChI | InChI=1S/C11H19N3O3S/c1-5-17-11-6-10(13-9(3)14-11)12-8(2)7-18(4,15)16/h6,8H,5,7H2,1-4H3,(H,12,13,14) |
| InChIKey | MIERODIDOHPLON-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |