C12H20N4O2 — CID 66325980
6-methoxy-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine (PubChem CID 66325980) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 6-methoxy-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine.
| Compound Name | 6-methoxy-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66325980 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 6-methoxy-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine |
| SMILES | COc1cc(NCCCN2CCOCC2)ncn1 |
| InChI | InChI=1S/C12H20N4O2/c1-17-12-9-11(14-10-15-12)13-3-2-4-16-5-7-18-8-6-16/h9-10H,2-8H2,1H3,(H,13,14,15) |
| InChIKey | DDZWMLZDKBOIDR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|