C17H15N5O3S — CID 663279
3-pyridin-3-yl-6-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 663279) has the molecular formula C17H15N5O3S and a molecular weight of 369.41 g/mol. Its IUPAC name is 3-pyridin-3-yl-6-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-pyridin-3-yl-6-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 663279 |
| Molecular Formula | C17H15N5O3S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 3-pyridin-3-yl-6-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1cc(-c2nn3c(-c4cccnc4)nnc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C17H15N5O3S/c1-23-12-7-11(8-13(24-2)14(12)25-3)16-21-22-15(19-20-17(22)26-16)10-5-4-6-18-9-10/h4-9H,1-3H3 |
| InChIKey | CBUYMBMOSJRBRH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |