C10H14F3N3O2 — CID 66329209
6-ethoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine (PubChem CID 66329209) has the molecular formula C10H14F3N3O2 and a molecular weight of 265.23 g/mol. Its IUPAC name is 6-ethoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine.
| Compound Name | 6-ethoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66329209 |
| Molecular Formula | C10H14F3N3O2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 6-ethoxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
| SMILES | CCOc1cc(NCCOCC(F)(F)F)ncn1 |
| InChI | InChI=1S/C10H14F3N3O2/c1-2-18-9-5-8(15-7-16-9)14-3-4-17-6-10(11,12)13/h5,7H,2-4,6H2,1H3,(H,14,15,16) |
| InChIKey | PDRZFMASUFMDBQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|