C18H21N3O3 — CID 663293
1-tert-butyl-5-(2,3-dihydro-1H-inden-5-yliminomethyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 663293) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-tert-butyl-5-(2,3-dihydro-1H-inden-5-yliminomethyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-tert-butyl-5-(2,3-dihydro-1H-inden-5-yliminomethyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 663293 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-tert-butyl-5-(2,3-dihydro-1H-inden-5-yliminomethyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | CC(C)(C)n1c(O)c(/C=N/c2ccc3c(c2)CCC3)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H21N3O3/c1-18(2,3)21-16(23)14(15(22)20-17(21)24)10-19-13-8-7-11-5-4-6-12(11)9-13/h7-10,23H,4-6H2,1-3H3,(H,20,22,24)/b19-10+ |
| InChIKey | ZNVLWHVGIGMDAE-VXLYETTFSA-N |
| XLogP | 2.24 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|