C8H9F3N2O2 — CID 66329539
5-ethyl-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 66329539) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 5-ethyl-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 5-ethyl-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66329539 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 5-ethyl-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | CCc1cn(CC(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9F3N2O2/c1-2-5-3-13(4-8(9,10)11)7(15)12-6(5)14/h3H,2,4H2,1H3,(H,12,14,15) |
| InChIKey | SVQOGGKDPMJGLV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |