About 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione
5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione (PubChem CID 66329931) has the molecular formula C11H13N3O2S
and a molecular weight of 251.31 g/mol. Its IUPAC name is 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione |
| PubChem CID | 66329931 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione |
| SMILES | CCc1cn(Cc2cnc(C)s2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H13N3O2S/c1-3-8-5-14(11(16)13-10(8)15)6-9-4-12-7(2)17-9/h4-5H,3,6H2,1-2H3,(H,13,15,16) |
| InChIKey | GNDAQSRUKIJADT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione?
The IUPAC name of 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione (CID 66329931) is 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione.
What is the SMILES notation for 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione?
The canonical SMILES for 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione is CCc1cn(Cc2cnc(C)s2)c(=O)[nH]c1=O.
What is the InChIKey of 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione?
The InChIKey is GNDAQSRUKIJADT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2S/c1-3-8-5-14(11(16)13-10(8)15)6-9-4-12-7(2)17-9/h4-5H,3,6H2,1-2H3,(H,13,15,16).
What are the key properties of 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione?
5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione has a molecular weight of 251.31 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-2,4-dione is sourced from PubChem (CID 66329931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).