C13H21N3O3 — CID 66332496
2-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-2-methylpentanoic acid (PubChem CID 66332496) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-2-methylpentanoic acid.
| Compound Name | 2-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 66332496 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(Nc1cc(OCC)nc(C)n1)C(=O)O |
| InChI | InChI=1S/C13H21N3O3/c1-5-7-13(4,12(17)18)16-10-8-11(19-6-2)15-9(3)14-10/h8H,5-7H2,1-4H3,(H,17,18)(H,14,15,16) |
| InChIKey | MFVKMQIIIHSAPM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |