C13H12N2O4 — CID 66334630
3-[[(4-methyl-1,2-oxazole-5-carbonyl)amino]methyl]benzoic acid (PubChem CID 66334630) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-[[(4-methyl-1,2-oxazole-5-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(4-methyl-1,2-oxazole-5-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 66334630 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-[[(4-methyl-1,2-oxazole-5-carbonyl)amino]methyl]benzoic acid |
| SMILES | Cc1cnoc1C(=O)NCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C13H12N2O4/c1-8-6-15-19-11(8)12(16)14-7-9-3-2-4-10(5-9)13(17)18/h2-6H,7H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | DKEODQJIBVXZMS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |