About N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide
N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide (PubChem CID 66334957) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 66334957 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cnoc1C(=O)N(C)CC1CC(O)C1 |
| InChI | InChI=1S/C11H16N2O3/c1-7-5-12-16-10(7)11(15)13(2)6-8-3-9(14)4-8/h5,8-9,14H,3-4,6H2,1-2H3 |
| InChIKey | UIBRMBFLGNCQJO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide (CID 66334957) is N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide is Cc1cnoc1C(=O)N(C)CC1CC(O)C1.
What is the InChIKey of N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide?
The InChIKey is UIBRMBFLGNCQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-7-5-12-16-10(7)11(15)13(2)6-8-3-9(14)4-8/h5,8-9,14H,3-4,6H2,1-2H3.
What are the key properties of N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide?
N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide has a molecular weight of 224.26 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-hydroxycyclobutyl)methyl]-N,4-dimethyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 66334957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).