About 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol
1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol (PubChem CID 66336373) has the molecular formula C11H23F3N2O
and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol |
| PubChem CID | 66336373 |
| Molecular Formula | C11H23F3N2O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CCN(CC(F)(F)F)CC(C)(O)CNC(C)C |
| InChI | InChI=1S/C11H23F3N2O/c1-5-16(8-11(12,13)14)7-10(4,17)6-15-9(2)3/h9,15,17H,5-8H2,1-4H3 |
| InChIKey | QCSFJINFCBWBCJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol?
The IUPAC name of 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol (CID 66336373) is 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol.
What is the SMILES notation for 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol?
The canonical SMILES for 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol is CCN(CC(F)(F)F)CC(C)(O)CNC(C)C.
What is the InChIKey of 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol?
The InChIKey is QCSFJINFCBWBCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23F3N2O/c1-5-16(8-11(12,13)14)7-10(4,17)6-15-9(2)3/h9,15,17H,5-8H2,1-4H3.
What are the key properties of 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol?
1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol has a molecular weight of 256.31 g/mol, XLogP of 1.62, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[ethyl(2,2,2-trifluoroethyl)amino]-2-methyl-3-(propan-2-ylamino)propan-2-ol is sourced from PubChem (CID 66336373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).