C12H18FN3O2 — CID 66338215
hydrazinyl 3-[1-(2-fluorophenyl)ethyl-methylamino]propanoate (PubChem CID 66338215) has the molecular formula C12H18FN3O2 and a molecular weight of 255.29 g/mol. Its IUPAC name is hydrazinyl 3-[1-(2-fluorophenyl)ethyl-methylamino]propanoate.
| Compound Name | hydrazinyl 3-[1-(2-fluorophenyl)ethyl-methylamino]propanoate |
|---|---|
| PubChem CID | 66338215 |
| Molecular Formula | C12H18FN3O2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | hydrazinyl 3-[1-(2-fluorophenyl)ethyl-methylamino]propanoate |
| SMILES | CC(c1ccccc1F)N(C)CCC(=O)ONN |
| InChI | InChI=1S/C12H18FN3O2/c1-9(10-5-3-4-6-11(10)13)16(2)8-7-12(17)18-15-14/h3-6,9,15H,7-8,14H2,1-2H3 |
| InChIKey | NTJWBDZQMNPXCB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|