C9H15N3O3 — CID 66338395
hydrazinyl 3-[furan-2-ylmethyl(methyl)amino]propanoate (PubChem CID 66338395) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is hydrazinyl 3-[furan-2-ylmethyl(methyl)amino]propanoate.
| Compound Name | hydrazinyl 3-[furan-2-ylmethyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 66338395 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | hydrazinyl 3-[furan-2-ylmethyl(methyl)amino]propanoate |
| SMILES | CN(CCC(=O)ONN)Cc1ccco1 |
| InChI | InChI=1S/C9H15N3O3/c1-12(5-4-9(13)15-11-10)7-8-3-2-6-14-8/h2-3,6,11H,4-5,7,10H2,1H3 |
| InChIKey | WCAJHQKHXUOGJK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|