C16H29NO2 — CID 66339070
tert-butyl 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]propanoate (PubChem CID 66339070) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is tert-butyl 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]propanoate.
| Compound Name | tert-butyl 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 66339070 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | tert-butyl 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)N(C)CC1CC2CCC1C2 |
| InChI | InChI=1S/C16H29NO2/c1-11(15(18)19-16(2,3)4)17(5)10-14-9-12-6-7-13(14)8-12/h11-14H,6-10H2,1-5H3 |
| InChIKey | NERLGTUSJHZAMF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |