About tert-butyl 2-pyrazin-2-ylpropanoate
tert-butyl 2-pyrazin-2-ylpropanoate (PubChem CID 66339447) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is tert-butyl 2-pyrazin-2-ylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 2-pyrazin-2-ylpropanoate |
| PubChem CID | 66339447 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | tert-butyl 2-pyrazin-2-ylpropanoate |
| SMILES | CC(C(=O)OC(C)(C)C)c1cnccn1 |
| InChI | InChI=1S/C11H16N2O2/c1-8(9-7-12-5-6-13-9)10(14)15-11(2,3)4/h5-8H,1-4H3 |
| InChIKey | KSYCMLWDBIPVEH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-pyrazin-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-pyrazin-2-ylpropanoate?
The IUPAC name of tert-butyl 2-pyrazin-2-ylpropanoate (CID 66339447) is tert-butyl 2-pyrazin-2-ylpropanoate.
What is the SMILES notation for tert-butyl 2-pyrazin-2-ylpropanoate?
The canonical SMILES for tert-butyl 2-pyrazin-2-ylpropanoate is CC(C(=O)OC(C)(C)C)c1cnccn1.
What is the InChIKey of tert-butyl 2-pyrazin-2-ylpropanoate?
The InChIKey is KSYCMLWDBIPVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-8(9-7-12-5-6-13-9)10(14)15-11(2,3)4/h5-8H,1-4H3.
What are the key properties of tert-butyl 2-pyrazin-2-ylpropanoate?
tert-butyl 2-pyrazin-2-ylpropanoate has a molecular weight of 208.26 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-pyrazin-2-ylpropanoate is sourced from PubChem (CID 66339447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).