C21H22N4O5S — CID 663406
6-(2,5-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 663406) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-(2,5-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 663406 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | COc1ccc(OC)c(C2=Nn3c(nnc3-c3cc(OC)c(OC)c(OC)c3)SC2)c1 |
| InChI | InChI=1S/C21H22N4O5S/c1-26-13-6-7-16(27-2)14(10-13)15-11-31-21-23-22-20(25(21)24-15)12-8-17(28-3)19(30-5)18(9-12)29-4/h6-10H,11H2,1-5H3 |
| InChIKey | RDCLHQFCTBKPOO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |