C13H21IN4 — CID 66340622
N-[[1-(5-iodopyrimidin-4-yl)piperidin-3-yl]methyl]propan-2-amine (PubChem CID 66340622) has the molecular formula C13H21IN4 and a molecular weight of 360.24 g/mol. Its IUPAC name is N-[[1-(5-iodopyrimidin-4-yl)piperidin-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-(5-iodopyrimidin-4-yl)piperidin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66340622 |
| Molecular Formula | C13H21IN4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[[1-(5-iodopyrimidin-4-yl)piperidin-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1CCCN(c2ncncc2I)C1 |
| InChI | InChI=1S/C13H21IN4/c1-10(2)16-6-11-4-3-5-18(8-11)13-12(14)7-15-9-17-13/h7,9-11,16H,3-6,8H2,1-2H3 |
| InChIKey | FROWGZBGZHKLOR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|